C13H20F2N2O3S — CID 86931192
1-[[[butyl(methyl)sulfamoyl]amino]methyl]-2-(difluoromethoxy)benzene (PubChem CID 86931192) has the molecular formula C13H20F2N2O3S and a molecular weight of 322.38 g/mol. Its IUPAC name is 1-[[[butyl(methyl)sulfamoyl]amino]methyl]-2-(difluoromethoxy)benzene.
| Compound Name | 1-[[[butyl(methyl)sulfamoyl]amino]methyl]-2-(difluoromethoxy)benzene |
|---|---|
| PubChem CID | 86931192 |
| Molecular Formula | C13H20F2N2O3S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-[[[butyl(methyl)sulfamoyl]amino]methyl]-2-(difluoromethoxy)benzene |
| SMILES | CCCCN(C)S(=O)(=O)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C13H20F2N2O3S/c1-3-4-9-17(2)21(18,19)16-10-11-7-5-6-8-12(11)20-13(14)15/h5-8,13,16H,3-4,9-10H2,1-2H3 |
| InChIKey | VOUATTKSIISYTG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |