C49H45O2+ — CID 72520922
6-methyl-8-[5-(6-methyl-2,4-diphenyl-6,7,8,8a-tetrahydro-5H-chromen-8-yl)penta-2,4-dienylidene]-2,4-diphenyl-6,7-dihydro-5H-chromen-1-ium (PubChem CID 72520922) has the molecular formula C49H45O2+ and a molecular weight of 665.90 g/mol. Its IUPAC name is 6-methyl-8-[5-(6-methyl-2,4-diphenyl-6,7,8,8a-tetrahydro-5H-chromen-8-yl)penta-2,4-dienylidene]-2,4-diphenyl-6,7-dihydro-5H-chromen-1-ium.
| Compound Name | 6-methyl-8-[5-(6-methyl-2,4-diphenyl-6,7,8,8a-tetrahydro-5H-chromen-8-yl)penta-2,4-dienylidene]-2,4-diphenyl-6,7-dihydro-5H-chromen-1-ium |
|---|---|
| PubChem CID | 72520922 |
| Molecular Formula | C49H45O2+ |
| Molecular Weight | 665.90 g/mol |
| Exact Mass | 665.34 |
| IUPAC Name | 6-methyl-8-[5-(6-methyl-2,4-diphenyl-6,7,8,8a-tetrahydro-5H-chromen-8-yl)penta-2,4-dienylidene]-2,4-diphenyl-6,7-dihydro-5H-chromen-1-ium |
| SMILES | CC1CC(=CC=CC=CC2CC(C)CC3=C(c4ccccc4)C=C(c4ccccc4)OC32)c2[o+]c(-c3ccccc3)cc(-c3ccccc3)c2C1 |
| InChI | InChI=1S/C49H45O2/c1-34-28-40(48-44(30-34)42(36-18-8-3-9-19-36)32-46(50-48)38-22-12-5-13-23-38)26-16-7-17-27-41-29-35(2)31-45-43(37-20-10-4-11-21-37)33-47(51-49(41)45)39-24-14-6-15-25-39/h3-27,32-35,40,48H,28-31H2,1-2H3/q+1 |
| InChIKey | DOWSBDWOUPSPJZ-UHFFFAOYSA-N |
| XLogP | 12.91 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.90 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|