C21H21FN2O2S — CID 72529825
2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 3-phenylprop-2-enoate (PubChem CID 72529825) has the molecular formula C21H21FN2O2S and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 3-phenylprop-2-enoate.
| Compound Name | 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 72529825 |
| Molecular Formula | C21H21FN2O2S |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2-[(4-fluoro-2,3-dihydro-1H-inden-1-yl)carbamothioylamino]ethyl 3-phenylprop-2-enoate |
| SMILES | O=C(C=Cc1ccccc1)OCCNC(=S)NC1CCc2c(F)cccc21 |
| InChI | InChI=1S/C21H21FN2O2S/c22-18-8-4-7-17-16(18)10-11-19(17)24-21(27)23-13-14-26-20(25)12-9-15-5-2-1-3-6-15/h1-9,12,19H,10-11,13-14H2,(H2,23,24,27) |
| InChIKey | HLOCZGRPCKUJRN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|