C24H30N2OS — CID 72563899
6-[(4-prop-1-enylcyclohexyl)methylsulfanyl]-2-propyl-3,4-dihydro-2H-chromene-7,8-dicarbonitrile (PubChem CID 72563899) has the molecular formula C24H30N2OS and a molecular weight of 394.58 g/mol. Its IUPAC name is 6-[(4-prop-1-enylcyclohexyl)methylsulfanyl]-2-propyl-3,4-dihydro-2H-chromene-7,8-dicarbonitrile.
| Compound Name | 6-[(4-prop-1-enylcyclohexyl)methylsulfanyl]-2-propyl-3,4-dihydro-2H-chromene-7,8-dicarbonitrile |
|---|---|
| PubChem CID | 72563899 |
| Molecular Formula | C24H30N2OS |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 6-[(4-prop-1-enylcyclohexyl)methylsulfanyl]-2-propyl-3,4-dihydro-2H-chromene-7,8-dicarbonitrile |
| SMILES | CC=CC1CCC(CSc2cc3c(c(C#N)c2C#N)OC(CCC)CC3)CC1 |
| InChI | InChI=1S/C24H30N2OS/c1-3-5-17-7-9-18(10-8-17)16-28-23-13-19-11-12-20(6-4-2)27-24(19)22(15-26)21(23)14-25/h3,5,13,17-18,20H,4,6-12,16H2,1-2H3 |
| InChIKey | HSKFPOZUIXCISR-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|