C12H19N2OS3+ — CID 7258186
(5S)-3-ethyl-5-[(2R)-3-ethyl-4,5-dimethyl-2,3-dihydro-1,3-thiazol-3-ium-2-yl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 7258186) has the molecular formula C12H19N2OS3+ and a molecular weight of 303.50 g/mol. Its IUPAC name is (5S)-3-ethyl-5-[(2R)-3-ethyl-4,5-dimethyl-2,3-dihydro-1,3-thiazol-3-ium-2-yl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5S)-3-ethyl-5-[(2R)-3-ethyl-4,5-dimethyl-2,3-dihydro-1,3-thiazol-3-ium-2-yl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 7258186 |
| Molecular Formula | C12H19N2OS3+ |
| Molecular Weight | 303.50 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (5S)-3-ethyl-5-[(2R)-3-ethyl-4,5-dimethyl-2,3-dihydro-1,3-thiazol-3-ium-2-yl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)[C@@H]([C@H]2SC(C)=C(C)[NH+]2CC)SC1=S |
| InChI | InChI=1S/C12H18N2OS3/c1-5-13-7(3)8(4)17-11(13)9-10(15)14(6-2)12(16)18-9/h9,11H,5-6H2,1-4H3/p+1/t9-,11+/m0/s1 |
| InChIKey | QMLULCPFFMJYPR-GXSJLCMTSA-O |
| XLogP | 1.46 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.50 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|