C28H29NO5 — CID 72628437
[4-[(5,6-dimethoxy-2-oxo-1H-indol-3-ylidene)methyl]phenyl] adamantane-1-carboxylate (PubChem CID 72628437) has the molecular formula C28H29NO5 and a molecular weight of 459.54 g/mol. Its IUPAC name is [4-[(5,6-dimethoxy-2-oxo-1H-indol-3-ylidene)methyl]phenyl] adamantane-1-carboxylate.
| Compound Name | [4-[(5,6-dimethoxy-2-oxo-1H-indol-3-ylidene)methyl]phenyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 72628437 |
| Molecular Formula | C28H29NO5 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | [4-[(5,6-dimethoxy-2-oxo-1H-indol-3-ylidene)methyl]phenyl] adamantane-1-carboxylate |
| SMILES | COc1cc2c(cc1OC)C(=Cc1ccc(OC(=O)C34CC5CC(CC(C5)C3)C4)cc1)C(=O)N2 |
| InChI | InChI=1S/C28H29NO5/c1-32-24-11-21-22(26(30)29-23(21)12-25(24)33-2)10-16-3-5-20(6-4-16)34-27(31)28-13-17-7-18(14-28)9-19(8-17)15-28/h3-6,10-12,17-19H,7-9,13-15H2,1-2H3,(H,29,30) |
| InChIKey | SZMDWPPUDMUKME-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|