C19H29ClN4O3 — CID 72690126
tert-butyl N-[[1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclopentyl]methyl]carbamate (PubChem CID 72690126) has the molecular formula C19H29ClN4O3 and a molecular weight of 396.92 g/mol. Its IUPAC name is tert-butyl N-[[1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 72690126 |
| Molecular Formula | C19H29ClN4O3 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | tert-butyl N-[[1-[3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoylamino]cyclopentyl]methyl]carbamate |
| SMILES | Cc1nn(C)c(Cl)c1C=CC(=O)NC1(CNC(=O)OC(C)(C)C)CCCC1 |
| InChI | InChI=1S/C19H29ClN4O3/c1-13-14(16(20)24(5)23-13)8-9-15(25)22-19(10-6-7-11-19)12-21-17(26)27-18(2,3)4/h8-9H,6-7,10-12H2,1-5H3,(H,21,26)(H,22,25) |
| InChIKey | SGGXOCCCZQBKCD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|