C28H28N6O3 — CID 72708285
3-[1-(3-morpholin-4-ylpropyl)pyrazolo[5,4-b]pyridin-3-yl]-4-(1-prop-2-enylindol-3-yl)pyrrole-2,5-dione (PubChem CID 72708285) has the molecular formula C28H28N6O3 and a molecular weight of 496.57 g/mol. Its IUPAC name is 3-[1-(3-morpholin-4-ylpropyl)pyrazolo[5,4-b]pyridin-3-yl]-4-(1-prop-2-enylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[1-(3-morpholin-4-ylpropyl)pyrazolo[5,4-b]pyridin-3-yl]-4-(1-prop-2-enylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 72708285 |
| Molecular Formula | C28H28N6O3 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 3-[1-(3-morpholin-4-ylpropyl)pyrazolo[5,4-b]pyridin-3-yl]-4-(1-prop-2-enylindol-3-yl)pyrrole-2,5-dione |
| SMILES | C=CCn1cc(C2=C(c3nn(CCCN4CCOCC4)c4ncccc34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C28H28N6O3/c1-2-11-33-18-21(19-7-3-4-9-22(19)33)23-24(28(36)30-27(23)35)25-20-8-5-10-29-26(20)34(31-25)13-6-12-32-14-16-37-17-15-32/h2-5,7-10,18H,1,6,11-17H2,(H,30,35,36) |
| InChIKey | LROOHXOHTARELI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|