C26H28N4O — CID 72709648
1-methyl-N-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]piperidine-4-carboxamide (PubChem CID 72709648) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol. Its IUPAC name is 1-methyl-N-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-methyl-N-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 72709648 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 1-methyl-N-[(E)-[4-(N-phenylanilino)phenyl]methylideneamino]piperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)N/N=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C26H28N4O/c1-29-18-16-22(17-19-29)26(31)28-27-20-21-12-14-25(15-13-21)30(23-8-4-2-5-9-23)24-10-6-3-7-11-24/h2-15,20,22H,16-19H2,1H3,(H,28,31)/b27-20+ |
| InChIKey | LDFMSQYOKTXGDR-NHFJDJAPSA-N |
| XLogP | 4.95 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|