C21H33BrO7P2 — CID 72721097
[(E)-4-(3-bromophenyl)-1-[(3S)-3,7-dimethyloct-6-enoxy]-1-phosphonopent-3-enyl]phosphonic acid (PubChem CID 72721097) has the molecular formula C21H33BrO7P2 and a molecular weight of 539.34 g/mol. Its IUPAC name is [(E)-4-(3-bromophenyl)-1-[(3S)-3,7-dimethyloct-6-enoxy]-1-phosphonopent-3-enyl]phosphonic acid.
| Compound Name | [(E)-4-(3-bromophenyl)-1-[(3S)-3,7-dimethyloct-6-enoxy]-1-phosphonopent-3-enyl]phosphonic acid |
|---|---|
| PubChem CID | 72721097 |
| Molecular Formula | C21H33BrO7P2 |
| Molecular Weight | 539.34 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | [(E)-4-(3-bromophenyl)-1-[(3S)-3,7-dimethyloct-6-enoxy]-1-phosphonopent-3-enyl]phosphonic acid |
| SMILES | CC(C)=CCC[C@H](C)CCOC(C/C=C(\C)c1cccc(Br)c1)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C21H33BrO7P2/c1-16(2)7-5-8-17(3)12-14-29-21(30(23,24)25,31(26,27)28)13-11-18(4)19-9-6-10-20(22)15-19/h6-7,9-11,15,17H,5,8,12-14H2,1-4H3,(H2,23,24,25)(H2,26,27,28)/b18-11+/t17-/m0/s1 |
| InChIKey | ZRBXHNQPUASDER-SZLZGVTBSA-N |
| XLogP | 6.04 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.34 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|