C17H32NO4+ — CID 72723794
[(2R,3R)-2,3-bis[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]methyl-trimethylazanium (PubChem CID 72723794) has the molecular formula C17H32NO4+ and a molecular weight of 314.45 g/mol. Its IUPAC name is [(2R,3R)-2,3-bis[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]methyl-trimethylazanium.
| Compound Name | [(2R,3R)-2,3-bis[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 72723794 |
| Molecular Formula | C17H32NO4+ |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | [(2R,3R)-2,3-bis[(2-methylpropan-2-yl)oxycarbonyl]cyclopropyl]methyl-trimethylazanium |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C(C[N+](C)(C)C)[C@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H32NO4/c1-16(2,3)21-14(19)12-11(10-18(7,8)9)13(12)15(20)22-17(4,5)6/h11-13H,10H2,1-9H3/q+1/t12-,13-/m1/s1 |
| InChIKey | AGEHADGTMAACTC-CHWSQXEVSA-N |
| XLogP | 2.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|