About 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one
1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one (PubChem CID 72725655) has the molecular formula C20H14N3O4+
and a molecular weight of 360.35 g/mol. Its IUPAC name is 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one.
Molecular Properties
| Compound Name | 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one |
| PubChem CID | 72725655 |
| Molecular Formula | C20H14N3O4+ |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one |
| SMILES | O=C1NC(c2c(=O)o[nH][n+]2-c2ccccc2)c2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C20H13N3O4/c24-19-18(23(22-27-19)13-7-2-1-3-8-13)17-16-14-9-5-4-6-12(14)10-11-15(16)26-20(25)21-17/h1-11,17H,(H-,21,22,24,25)/p+1 |
| InChIKey | PZJWKCKISGJZFR-UHFFFAOYSA-O |
| XLogP | 2.59 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one?
The IUPAC name of 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one (CID 72725655) is 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one.
What is the SMILES notation for 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one?
The canonical SMILES for 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one is O=C1NC(c2c(=O)o[nH][n+]2-c2ccccc2)c2c(ccc3ccccc23)O1.
What is the InChIKey of 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one?
The InChIKey is PZJWKCKISGJZFR-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H13N3O4/c24-19-18(23(22-27-19)13-7-2-1-3-8-13)17-16-14-9-5-4-6-12(14)10-11-15(16)26-20(25)21-17/h1-11,17H,(H-,21,22,24,25)/p+1.
What are the key properties of 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one?
1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one has a molecular weight of 360.35 g/mol, XLogP of 2.59, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one is sourced from PubChem (CID 72725655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).