C20H14N3O4+ — CID 72725655
1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one (PubChem CID 72725655) has the molecular formula C20H14N3O4+ and a molecular weight of 360.35 g/mol. Its IUPAC name is 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one.
| Compound Name | 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one |
|---|---|
| PubChem CID | 72725655 |
| Molecular Formula | C20H14N3O4+ |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 1-(5-oxo-3-phenyl-2H-oxadiazol-3-ium-4-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one |
| SMILES | O=C1NC(c2c(=O)o[nH][n+]2-c2ccccc2)c2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C20H13N3O4/c24-19-18(23(22-27-19)13-7-2-1-3-8-13)17-16-14-9-5-4-6-12(14)10-11-15(16)26-20(25)21-17/h1-11,17H,(H-,21,22,24,25)/p+1 |
| InChIKey | PZJWKCKISGJZFR-UHFFFAOYSA-O |
| XLogP | 2.59 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|