C14H23N4O3+ — CID 72729970
N-[4-amino-1,3-bis(2-methylpropyl)-2,6-dioxopyrimidin-3-ium-5-ylidene]acetamide (PubChem CID 72729970) has the molecular formula C14H23N4O3+ and a molecular weight of 295.36 g/mol. Its IUPAC name is N-[4-amino-1,3-bis(2-methylpropyl)-2,6-dioxopyrimidin-3-ium-5-ylidene]acetamide.
| Compound Name | N-[4-amino-1,3-bis(2-methylpropyl)-2,6-dioxopyrimidin-3-ium-5-ylidene]acetamide |
|---|---|
| PubChem CID | 72729970 |
| Molecular Formula | C14H23N4O3+ |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | N-[4-amino-1,3-bis(2-methylpropyl)-2,6-dioxopyrimidin-3-ium-5-ylidene]acetamide |
| SMILES | CC(=O)/N=C1\C(=O)N(CC(C)C)C(=O)[N+](CC(C)C)=C1N |
| InChI | InChI=1S/C14H22N4O3/c1-8(2)6-17-12(15)11(16-10(5)19)13(20)18(14(17)21)7-9(3)4/h8-9,15H,6-7H2,1-5H3/p+1/b16-11- |
| InChIKey | LLMZKIKSQWHDCY-WJDWOHSUSA-O |
| XLogP | 0.62 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|