C7H11N4O2+ — CID 76844507
6-amino-1,3-dimethyl-5-methyliminopyrimidin-1-ium-2,4-dione (PubChem CID 76844507) has the molecular formula C7H11N4O2+ and a molecular weight of 183.19 g/mol. Its IUPAC name is 6-amino-1,3-dimethyl-5-methyliminopyrimidin-1-ium-2,4-dione.
| Compound Name | 6-amino-1,3-dimethyl-5-methyliminopyrimidin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 76844507 |
| Molecular Formula | C7H11N4O2+ |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 6-amino-1,3-dimethyl-5-methyliminopyrimidin-1-ium-2,4-dione |
| SMILES | C/N=C1\C(=O)N(C)C(=O)[N+](C)=C1N |
| InChI | InChI=1S/C7H10N4O2/c1-9-4-5(8)10(2)7(13)11(3)6(4)12/h8H,1-3H3/p+1/b9-4- |
| InChIKey | MSMBEDHMRZYQLR-WTKPLQERSA-O |
| XLogP | -1.35 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|