C12H19N4O3+ — CID 75094852
N-[4-amino-1-methyl-3-(2-methylbutyl)-2,6-dioxopyrimidin-3-ium-5-ylidene]acetamide (PubChem CID 75094852) has the molecular formula C12H19N4O3+ and a molecular weight of 267.31 g/mol. Its IUPAC name is N-[4-amino-1-methyl-3-(2-methylbutyl)-2,6-dioxopyrimidin-3-ium-5-ylidene]acetamide.
| Compound Name | N-[4-amino-1-methyl-3-(2-methylbutyl)-2,6-dioxopyrimidin-3-ium-5-ylidene]acetamide |
|---|---|
| PubChem CID | 75094852 |
| Molecular Formula | C12H19N4O3+ |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-[4-amino-1-methyl-3-(2-methylbutyl)-2,6-dioxopyrimidin-3-ium-5-ylidene]acetamide |
| SMILES | CCC(C)C[N+]1=C(N)/C(=N/C(C)=O)C(=O)N(C)C1=O |
| InChI | InChI=1S/C12H18N4O3/c1-5-7(2)6-16-10(13)9(14-8(3)17)11(18)15(4)12(16)19/h7,13H,5-6H2,1-4H3/p+1/b14-9- |
| InChIKey | OOAJTXCTMYPHQG-ZROIWOOFSA-O |
| XLogP | -0.02 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|