C12H19N4O3+ — CID 74041508
N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-3-ium-5-ylidene)acetamide (PubChem CID 74041508) has the molecular formula C12H19N4O3+ and a molecular weight of 267.31 g/mol. Its IUPAC name is N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-3-ium-5-ylidene)acetamide.
| Compound Name | N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-3-ium-5-ylidene)acetamide |
|---|---|
| PubChem CID | 74041508 |
| Molecular Formula | C12H19N4O3+ |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-3-ium-5-ylidene)acetamide |
| SMILES | CCCN1C(=O)/C(=N\C(C)=O)C(N)=[N+](CCC)C1=O |
| InChI | InChI=1S/C12H18N4O3/c1-4-6-15-10(13)9(14-8(3)17)11(18)16(7-5-2)12(15)19/h13H,4-7H2,1-3H3/p+1/b14-9- |
| InChIKey | AAVZVRCWDRPZPS-ZROIWOOFSA-O |
| XLogP | 0.13 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|