C27H30N2O3 — CID 72735564
(1R,14S,15R)-25-(2-ethoxyethyl)-4,25-diazahexacyclo[13.7.3.01,14.03,12.05,10.017,22]pentacosa-3,5,7,9,11,17(22),18,20-octaene-14,20-diol (PubChem CID 72735564) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is (1R,14S,15R)-25-(2-ethoxyethyl)-4,25-diazahexacyclo[13.7.3.01,14.03,12.05,10.017,22]pentacosa-3,5,7,9,11,17(22),18,20-octaene-14,20-diol.
| Compound Name | (1R,14S,15R)-25-(2-ethoxyethyl)-4,25-diazahexacyclo[13.7.3.01,14.03,12.05,10.017,22]pentacosa-3,5,7,9,11,17(22),18,20-octaene-14,20-diol |
|---|---|
| PubChem CID | 72735564 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | (1R,14S,15R)-25-(2-ethoxyethyl)-4,25-diazahexacyclo[13.7.3.01,14.03,12.05,10.017,22]pentacosa-3,5,7,9,11,17(22),18,20-octaene-14,20-diol |
| SMILES | CCOCCN1CC[C@]23Cc4nc5ccccc5cc4C[C@@]2(O)[C@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C27H30N2O3/c1-2-32-12-11-29-10-9-26-17-24-20(13-19-5-3-4-6-23(19)28-24)16-27(26,31)25(29)14-18-7-8-21(30)15-22(18)26/h3-8,13,15,25,30-31H,2,9-12,14,16-17H2,1H3/t25-,26-,27-/m1/s1 |
| InChIKey | FLSYAXDCNKMVBY-ZONZVBGPSA-N |
| XLogP | 3.38 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|