C32H33NO11 — CID 72737044
3-(3,4-dimethoxyphenyl)-1-[2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl]-4-(3,4,5-trimethoxyphenyl)pyrrole-2,5-dione (PubChem CID 72737044) has the molecular formula C32H33NO11 and a molecular weight of 607.61 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-[2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl]-4-(3,4,5-trimethoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-[2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl]-4-(3,4,5-trimethoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 72737044 |
| Molecular Formula | C32H33NO11 |
| Molecular Weight | 607.61 g/mol |
| Exact Mass | 607.21 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-[2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl]-4-(3,4,5-trimethoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(c3cc(OC)c(OC)c(OC)c3)C(=O)N(CC(=O)c3cc(OC)c(OC)c(OC)c3)C2=O)cc1OC |
| InChI | InChI=1S/C32H33NO11/c1-37-21-10-9-17(11-22(21)38-2)27-28(19-14-25(41-5)30(44-8)26(15-19)42-6)32(36)33(31(27)35)16-20(34)18-12-23(39-3)29(43-7)24(13-18)40-4/h9-15H,16H2,1-8H3 |
| InChIKey | UHJCYKLRLIJAGJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 128.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.61 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|