C20H26N4O3 — CID 72919032
4-methoxy-N-methyl-3-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]benzamide (PubChem CID 72919032) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-methoxy-N-methyl-3-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]benzamide.
| Compound Name | 4-methoxy-N-methyl-3-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 72919032 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 4-methoxy-N-methyl-3-[6-(2-morpholin-4-ylethylamino)-3-pyridinyl]benzamide |
| SMILES | CNC(=O)c1ccc(OC)c(-c2ccc(NCCN3CCOCC3)nc2)c1 |
| InChI | InChI=1S/C20H26N4O3/c1-21-20(25)15-3-5-18(26-2)17(13-15)16-4-6-19(23-14-16)22-7-8-24-9-11-27-12-10-24/h3-6,13-14H,7-12H2,1-2H3,(H,21,25)(H,22,23) |
| InChIKey | VYNXDYNGVLBQFS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |