C20H32N5O5+ — CID 7307085
ethyl 2-[[4-(dimethylamino)-3-(2-morpholin-4-ium-4-ylethylcarbamoyl)phenyl]carbamoylamino]acetate (PubChem CID 7307085) has the molecular formula C20H32N5O5+ and a molecular weight of 422.51 g/mol. Its IUPAC name is ethyl 2-[[4-(dimethylamino)-3-(2-morpholin-4-ium-4-ylethylcarbamoyl)phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-(dimethylamino)-3-(2-morpholin-4-ium-4-ylethylcarbamoyl)phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 7307085 |
| Molecular Formula | C20H32N5O5+ |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | ethyl 2-[[4-(dimethylamino)-3-(2-morpholin-4-ium-4-ylethylcarbamoyl)phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1ccc(N(C)C)c(C(=O)NCC[NH+]2CCOCC2)c1 |
| InChI | InChI=1S/C20H31N5O5/c1-4-30-18(26)14-22-20(28)23-15-5-6-17(24(2)3)16(13-15)19(27)21-7-8-25-9-11-29-12-10-25/h5-6,13H,4,7-12,14H2,1-3H3,(H,21,27)(H2,22,23,28)/p+1 |
| InChIKey | UDADMAVYLRMKEZ-UHFFFAOYSA-O |
| XLogP | -0.92 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|