C15H22N4O5S — CID 73134301
methyl 2-[[3-(5-cyclopentylsulfanyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate (PubChem CID 73134301) has the molecular formula C15H22N4O5S and a molecular weight of 370.43 g/mol. Its IUPAC name is methyl 2-[[3-(5-cyclopentylsulfanyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate.
| Compound Name | methyl 2-[[3-(5-cyclopentylsulfanyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate |
|---|---|
| PubChem CID | 73134301 |
| Molecular Formula | C15H22N4O5S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | methyl 2-[[3-(5-cyclopentylsulfanyltetrazol-1-yl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]acetate |
| SMILES | COC(=O)COC1COC2C1OCC2n1nnnc1SC1CCCC1 |
| InChI | InChI=1S/C15H22N4O5S/c1-21-12(20)8-22-11-7-24-13-10(6-23-14(11)13)19-15(16-17-18-19)25-9-4-2-3-5-9/h9-11,13-14H,2-8H2,1H3 |
| InChIKey | LIWHVAQJEOWQNW-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |