C10H14IN4O2+ — CID 73164666
1-(3-iodopropyl)-3,7-dimethyl-5H-purin-7-ium-2,6-dione (PubChem CID 73164666) has the molecular formula C10H14IN4O2+ and a molecular weight of 349.15 g/mol. Its IUPAC name is 1-(3-iodopropyl)-3,7-dimethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 1-(3-iodopropyl)-3,7-dimethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73164666 |
| Molecular Formula | C10H14IN4O2+ |
| Molecular Weight | 349.15 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 1-(3-iodopropyl)-3,7-dimethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)N(CCCI)C(=O)C2C1=NC=[N+]2C |
| InChI | InChI=1S/C10H14IN4O2/c1-13-6-12-8-7(13)9(16)15(5-3-4-11)10(17)14(8)2/h6-7H,3-5H2,1-2H3/q+1 |
| InChIKey | INIOWPIPMOMCMQ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.15 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|