C19H28N5O3+ — CID 73276745
9-cyclohexyl-1,7-dimethyl-3-(2-oxopropyl)-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione (PubChem CID 73276745) has the molecular formula C19H28N5O3+ and a molecular weight of 374.47 g/mol. Its IUPAC name is 9-cyclohexyl-1,7-dimethyl-3-(2-oxopropyl)-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione.
| Compound Name | 9-cyclohexyl-1,7-dimethyl-3-(2-oxopropyl)-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
|---|---|
| PubChem CID | 73276745 |
| Molecular Formula | C19H28N5O3+ |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 9-cyclohexyl-1,7-dimethyl-3-(2-oxopropyl)-4a,6,7,8-tetrahydropurino[7,8-a]pyrimidin-5-ium-2,4-dione |
| SMILES | CC(=O)CN1C(=O)C2C(=NC3=[N+]2CC(C)CN3C2CCCCC2)N(C)C1=O |
| InChI | InChI=1S/C19H28N5O3/c1-12-9-22(14-7-5-4-6-8-14)18-20-16-15(23(18)10-12)17(26)24(11-13(2)25)19(27)21(16)3/h12,14-15H,4-11H2,1-3H3/q+1 |
| InChIKey | BIACUFCWXQFITE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|