C20H26N2 — CID 7329767
(2R,3S,4S)-2-ethyl-3,6-dimethyl-N-(4-methylphenyl)-1,2,3,4-tetrahydroquinolin-4-amine (PubChem CID 7329767) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is (2R,3S,4S)-2-ethyl-3,6-dimethyl-N-(4-methylphenyl)-1,2,3,4-tetrahydroquinolin-4-amine.
| Compound Name | (2R,3S,4S)-2-ethyl-3,6-dimethyl-N-(4-methylphenyl)-1,2,3,4-tetrahydroquinolin-4-amine |
|---|---|
| PubChem CID | 7329767 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | (2R,3S,4S)-2-ethyl-3,6-dimethyl-N-(4-methylphenyl)-1,2,3,4-tetrahydroquinolin-4-amine |
| SMILES | CC[C@H]1Nc2ccc(C)cc2[C@@H](Nc2ccc(C)cc2)[C@H]1C |
| InChI | InChI=1S/C20H26N2/c1-5-18-15(4)20(21-16-9-6-13(2)7-10-16)17-12-14(3)8-11-19(17)22-18/h6-12,15,18,20-22H,5H2,1-4H3/t15-,18+,20-/m0/s1 |
| InChIKey | KPYCVMHJVPEANK-CVAIRZPRSA-N |
| XLogP | 5.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |