C26H22ClFN2O4S2 — CID 73350595
(2S)-2-[(5Z)-5-[[2-chloro-6-[(4-fluorophenyl)methoxy]quinolin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid (PubChem CID 73350595) has the molecular formula C26H22ClFN2O4S2 and a molecular weight of 545.06 g/mol. Its IUPAC name is (2S)-2-[(5Z)-5-[[2-chloro-6-[(4-fluorophenyl)methoxy]quinolin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid.
| Compound Name | (2S)-2-[(5Z)-5-[[2-chloro-6-[(4-fluorophenyl)methoxy]quinolin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 73350595 |
| Molecular Formula | C26H22ClFN2O4S2 |
| Molecular Weight | 545.06 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | (2S)-2-[(5Z)-5-[[2-chloro-6-[(4-fluorophenyl)methoxy]quinolin-3-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid |
| SMILES | CCC(C)[C@@H](C(=O)O)N1C(=O)/C(=C/c2cc3cc(OCc4ccc(F)cc4)ccc3nc2Cl)SC1=S |
| InChI | InChI=1S/C26H22ClFN2O4S2/c1-3-14(2)22(25(32)33)30-24(31)21(36-26(30)35)12-17-10-16-11-19(8-9-20(16)29-23(17)27)34-13-15-4-6-18(28)7-5-15/h4-12,14,22H,3,13H2,1-2H3,(H,32,33)/b21-12-/t14?,22-/m0/s1 |
| InChIKey | CIGUQRMRTSXRRY-SEUHCEMJSA-N |
| XLogP | 6.31 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.06 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|