C69H53Cl3N2O4 — CID 73351375
2,5,6-trichloro-1-[(2R,3S,4R,5R)-3,4-ditrityloxy-5-(trityloxymethyl)oxolan-2-yl]benzimidazole (PubChem CID 73351375) has the molecular formula C69H53Cl3N2O4 and a molecular weight of 1080.55 g/mol. Its IUPAC name is 2,5,6-trichloro-1-[(2R,3S,4R,5R)-3,4-ditrityloxy-5-(trityloxymethyl)oxolan-2-yl]benzimidazole.
| Compound Name | 2,5,6-trichloro-1-[(2R,3S,4R,5R)-3,4-ditrityloxy-5-(trityloxymethyl)oxolan-2-yl]benzimidazole |
|---|---|
| PubChem CID | 73351375 |
| Molecular Formula | C69H53Cl3N2O4 |
| Molecular Weight | 1080.55 g/mol |
| Exact Mass | 1078.31 |
| IUPAC Name | 2,5,6-trichloro-1-[(2R,3S,4R,5R)-3,4-ditrityloxy-5-(trityloxymethyl)oxolan-2-yl]benzimidazole |
| SMILES | Clc1cc2nc(Cl)n([C@@H]3O[C@H](COC(c4ccccc4)(c4ccccc4)c4ccccc4)[C@@H](OC(c4ccccc4)(c4ccccc4)c4ccccc4)[C@@H]3OC(c3ccccc3)(c3ccccc3)c3ccccc3)c2cc1Cl |
| InChI | InChI=1S/C69H53Cl3N2O4/c70-58-46-60-61(47-59(58)71)74(66(72)73-60)65-64(78-69(55-40-22-7-23-41-55,56-42-24-8-25-43-56)57-44-26-9-27-45-57)63(77-68(52-34-16-4-17-35-52,53-36-18-5-19-37-53)54-38-20-6-21-39-54)62(76-65)48-75-67(49-28-10-1-11-29-49,50-30-12-2-13-31-50)51-32-14-3-15-33-51/h1-47,62-65H,48H2/t62-,63-,64+,65-/m1/s1 |
| InChIKey | UYMFJJOQQGPWJK-RFLAFBFASA-N |
| XLogP | 16.66 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1080.55 |
| LogP ≤ 5 | 16.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|