C22H30FN5O3S — CID 73450518
N-cyclohexyl-2-[[7-(4-fluorophenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]acetamide (PubChem CID 73450518) has the molecular formula C22H30FN5O3S and a molecular weight of 463.58 g/mol. Its IUPAC name is N-cyclohexyl-2-[[7-(4-fluorophenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]acetamide.
| Compound Name | N-cyclohexyl-2-[[7-(4-fluorophenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 73450518 |
| Molecular Formula | C22H30FN5O3S |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-cyclohexyl-2-[[7-(4-fluorophenyl)-1,3-dimethyl-2,4-dioxo-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl]sulfanyl]acetamide |
| SMILES | CN1C(=O)C2C(SCC(=O)NC3CCCCC3)NC(c3ccc(F)cc3)NC2N(C)C1=O |
| InChI | InChI=1S/C22H30FN5O3S/c1-27-19-17(21(30)28(2)22(27)31)20(26-18(25-19)13-8-10-14(23)11-9-13)32-12-16(29)24-15-6-4-3-5-7-15/h8-11,15,17-20,25-26H,3-7,12H2,1-2H3,(H,24,29) |
| InChIKey | OTEROODZCQDARL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |