C19H27N3O5 — CID 7347354
methyl 2-[4-[6-[(4S,5R)-5-methyl-2-oxoimidazolidin-4-yl]hexanoylamino]phenoxy]acetate (PubChem CID 7347354) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is methyl 2-[4-[6-[(4S,5R)-5-methyl-2-oxoimidazolidin-4-yl]hexanoylamino]phenoxy]acetate.
| Compound Name | methyl 2-[4-[6-[(4S,5R)-5-methyl-2-oxoimidazolidin-4-yl]hexanoylamino]phenoxy]acetate |
|---|---|
| PubChem CID | 7347354 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | methyl 2-[4-[6-[(4S,5R)-5-methyl-2-oxoimidazolidin-4-yl]hexanoylamino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)CCCCC[C@@H]2NC(=O)N[C@@H]2C)cc1 |
| InChI | InChI=1S/C19H27N3O5/c1-13-16(22-19(25)20-13)6-4-3-5-7-17(23)21-14-8-10-15(11-9-14)27-12-18(24)26-2/h8-11,13,16H,3-7,12H2,1-2H3,(H,21,23)(H2,20,22,25)/t13-,16+/m1/s1 |
| InChIKey | HXOAPVRZQGHNGT-CJNGLKHVSA-N |
| XLogP | 2.20 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|