C14H20N4O4S2 — CID 7374755
(2S)-3-[4-(diethylaminodiazenyl)phenyl]sulfonyl-1,3-thiazolidine-2-carboxylic acid (PubChem CID 7374755) has the molecular formula C14H20N4O4S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is (2S)-3-[4-(diethylaminodiazenyl)phenyl]sulfonyl-1,3-thiazolidine-2-carboxylic acid.
| Compound Name | (2S)-3-[4-(diethylaminodiazenyl)phenyl]sulfonyl-1,3-thiazolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 7374755 |
| Molecular Formula | C14H20N4O4S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (2S)-3-[4-(diethylaminodiazenyl)phenyl]sulfonyl-1,3-thiazolidine-2-carboxylic acid |
| SMILES | CCN(CC)/N=N/c1ccc(S(=O)(=O)N2CCS[C@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C14H20N4O4S2/c1-3-17(4-2)16-15-11-5-7-12(8-6-11)24(21,22)18-9-10-23-13(18)14(19)20/h5-8,13H,3-4,9-10H2,1-2H3,(H,19,20)/b16-15+/t13-/m0/s1 |
| InChIKey | HVTGWLSYXUIULO-ZGTROFRASA-N |
| XLogP | 2.18 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|