C14H19KN4O4S2 — CID 23711880
potassium 3-[4-(diethylaminodiazenyl)phenyl]sulfonyl-1,3-thiazolidine-2-carboxylate (PubChem CID 23711880) has the molecular formula C14H19KN4O4S2 and a molecular weight of 410.56 g/mol. Its IUPAC name is potassium 3-[4-(diethylaminodiazenyl)phenyl]sulfonyl-1,3-thiazolidine-2-carboxylate.
| Compound Name | potassium 3-[4-(diethylaminodiazenyl)phenyl]sulfonyl-1,3-thiazolidine-2-carboxylate |
|---|---|
| PubChem CID | 23711880 |
| Molecular Formula | C14H19KN4O4S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | potassium 3-[4-(diethylaminodiazenyl)phenyl]sulfonyl-1,3-thiazolidine-2-carboxylate |
| SMILES | CCN(CC)/N=N/c1ccc(S(=O)(=O)N2CCSC2C(=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C14H20N4O4S2.K/c1-3-17(4-2)16-15-11-5-7-12(8-6-11)24(21,22)18-9-10-23-13(18)14(19)20;/h5-8,13H,3-4,9-10H2,1-2H3,(H,19,20);/q;+1/p-1/b16-15+; |
| InChIKey | OQJLUNDMEMYBOE-GEEYTBSJSA-M |
| XLogP | -2.16 |
| TPSA | 105.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|