C14H18N2O5S — CID 739175
(2R,4S)-4-ethyl-2-methyl-5-oxo-N-(4-sulfamoylphenyl)oxolane-2-carboxamide (PubChem CID 739175) has the molecular formula C14H18N2O5S and a molecular weight of 326.37 g/mol. Its IUPAC name is (2R,4S)-4-ethyl-2-methyl-5-oxo-N-(4-sulfamoylphenyl)oxolane-2-carboxamide.
| Compound Name | (2R,4S)-4-ethyl-2-methyl-5-oxo-N-(4-sulfamoylphenyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 739175 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (2R,4S)-4-ethyl-2-methyl-5-oxo-N-(4-sulfamoylphenyl)oxolane-2-carboxamide |
| SMILES | CC[C@H]1C[C@](C)(C(=O)Nc2ccc(S(N)(=O)=O)cc2)OC1=O |
| InChI | InChI=1S/C14H18N2O5S/c1-3-9-8-14(2,21-12(9)17)13(18)16-10-4-6-11(7-5-10)22(15,19)20/h4-7,9H,3,8H2,1-2H3,(H,16,18)(H2,15,19,20)/t9-,14+/m0/s1 |
| InChIKey | OQILGWUEUGZHJG-LKFCYVNXSA-N |
| XLogP | 1.00 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |