C20H25BN4O4 — CID 74408219
[3-methyl-1-[[2-phenyl-1-(pyrazine-2-carbonylamino)cyclopropanecarbonyl]amino]butyl]boronic acid (PubChem CID 74408219) has the molecular formula C20H25BN4O4 and a molecular weight of 396.26 g/mol. Its IUPAC name is [3-methyl-1-[[2-phenyl-1-(pyrazine-2-carbonylamino)cyclopropanecarbonyl]amino]butyl]boronic acid.
| Compound Name | [3-methyl-1-[[2-phenyl-1-(pyrazine-2-carbonylamino)cyclopropanecarbonyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 74408219 |
| Molecular Formula | C20H25BN4O4 |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [3-methyl-1-[[2-phenyl-1-(pyrazine-2-carbonylamino)cyclopropanecarbonyl]amino]butyl]boronic acid |
| SMILES | CC(C)CC(NC(=O)C1(NC(=O)c2cnccn2)CC1c1ccccc1)B(O)O |
| InChI | InChI=1S/C20H25BN4O4/c1-13(2)10-17(21(28)29)24-19(27)20(11-15(20)14-6-4-3-5-7-14)25-18(26)16-12-22-8-9-23-16/h3-9,12-13,15,17,28-29H,10-11H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | PNKACHYELCARIF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|