C15H23BN2O3 — CID 163814511
[(1R)-1-[[(2S)-1-amino-2-phenylcyclopropanecarbonyl]amino]-3-methylbutyl]boronic acid (PubChem CID 163814511) has the molecular formula C15H23BN2O3 and a molecular weight of 290.17 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-1-amino-2-phenylcyclopropanecarbonyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-1-amino-2-phenylcyclopropanecarbonyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 163814511 |
| Molecular Formula | C15H23BN2O3 |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | [(1R)-1-[[(2S)-1-amino-2-phenylcyclopropanecarbonyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)C1(N)C[C@H]1c1ccccc1)B(O)O |
| InChI | InChI=1S/C15H23BN2O3/c1-10(2)8-13(16(20)21)18-14(19)15(17)9-12(15)11-6-4-3-5-7-11/h3-7,10,12-13,20-21H,8-9,17H2,1-2H3,(H,18,19)/t12-,13-,15?/m0/s1 |
| InChIKey | NQDBMEVTOBENMT-QNIGDANOSA-N |
| XLogP | 0.41 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|