C16H17ClN5O4+ — CID 74415389
2-[8-(5-chloro-2-methylanilino)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetic acid (PubChem CID 74415389) has the molecular formula C16H17ClN5O4+ and a molecular weight of 378.80 g/mol. Its IUPAC name is 2-[8-(5-chloro-2-methylanilino)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetic acid.
| Compound Name | 2-[8-(5-chloro-2-methylanilino)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetic acid |
|---|---|
| PubChem CID | 74415389 |
| Molecular Formula | C16H17ClN5O4+ |
| Molecular Weight | 378.80 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2-[8-(5-chloro-2-methylanilino)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl]acetic acid |
| SMILES | Cc1ccc(Cl)cc1NC1=[N+](CC(=O)O)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C16H16ClN5O4/c1-8-4-5-9(17)6-10(8)18-15-19-13-12(22(15)7-11(23)24)14(25)21(3)16(26)20(13)2/h4-6,12H,7H2,1-3H3,(H,23,24)/p+1 |
| InChIKey | OJSNUDWWYHHRHS-UHFFFAOYSA-O |
| XLogP | 0.82 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.80 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|