C24H33N5OS — CID 74415456
N-[[1-[(2-phenyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide (PubChem CID 74415456) has the molecular formula C24H33N5OS and a molecular weight of 439.63 g/mol. Its IUPAC name is N-[[1-[(2-phenyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide.
| Compound Name | N-[[1-[(2-phenyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 74415456 |
| Molecular Formula | C24H33N5OS |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | N-[[1-[(2-phenyl-1,3-thiazol-5-yl)methyl]piperidin-3-yl]methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxamide |
| SMILES | O=C(NCC1CCCN(Cc2cnc(-c3ccccc3)s2)C1)C1NNC2CCCCC21 |
| InChI | InChI=1S/C24H33N5OS/c30-23(22-20-10-4-5-11-21(20)27-28-22)25-13-17-7-6-12-29(15-17)16-19-14-26-24(31-19)18-8-2-1-3-9-18/h1-3,8-9,14,17,20-22,27-28H,4-7,10-13,15-16H2,(H,25,30) |
| InChIKey | FOVFNMVGLMWDDQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |