About benzyl-[(2-bromo-4,5-dimethoxyphenyl)methyl]-(2-hydroxyethyl)azanium
benzyl-[(2-bromo-4,5-dimethoxyphenyl)methyl]-(2-hydroxyethyl)azanium (PubChem CID 7442845) has the molecular formula C18H23BrNO3+
and a molecular weight of 381.29 g/mol. Its IUPAC name is benzyl-[(2-bromo-4,5-dimethoxyphenyl)methyl]-(2-hydroxyethyl)azanium.
Molecular Properties
| Compound Name | benzyl-[(2-bromo-4,5-dimethoxyphenyl)methyl]-(2-hydroxyethyl)azanium |
| PubChem CID | 7442845 |
| Molecular Formula | C18H23BrNO3+ |
| Molecular Weight | 381.29 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | benzyl-[(2-bromo-4,5-dimethoxyphenyl)methyl]-(2-hydroxyethyl)azanium |
| SMILES | COc1cc(Br)c(C[NH+](CCO)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C18H22BrNO3/c1-22-17-10-15(16(19)11-18(17)23-2)13-20(8-9-21)12-14-6-4-3-5-7-14/h3-7,10-11,21H,8-9,12-13H2,1-2H3/p+1 |
| InChIKey | RMTGNKDNNKUNIJ-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 43.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl-[(2-bromo-4,5-dimethoxyphenyl)methyl]-(2-hydroxyethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-[(2-bromo-4,5-dimethoxyphenyl)methyl]-(2-hydroxyethyl)azanium?
The IUPAC name of benzyl-[(2-bromo-4,5-dimethoxyphenyl)methyl]-(2-hydroxyethyl)azanium (CID 7442845) is benzyl-[(2-bromo-4,5-dimethoxyphenyl)methyl]-(2-hydroxyethyl)azanium.
What is the SMILES notation for benzyl-[(2-bromo-4,5-dimethoxyphenyl)methyl]-(2-hydroxyethyl)azanium?
The canonical SMILES for benzyl-[(2-bromo-4,5-dimethoxyphenyl)methyl]-(2-hydroxyethyl)azanium is COc1cc(Br)c(C[NH+](CCO)Cc2ccccc2)cc1OC.
What is the InChIKey of benzyl-[(2-bromo-4,5-dimethoxyphenyl)methyl]-(2-hydroxyethyl)azanium?
The InChIKey is RMTGNKDNNKUNIJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H22BrNO3/c1-22-17-10-15(16(19)11-18(17)23-2)13-20(8-9-21)12-14-6-4-3-5-7-14/h3-7,10-11,21H,8-9,12-13H2,1-2H3/p+1.
What are the key properties of benzyl-[(2-bromo-4,5-dimethoxyphenyl)methyl]-(2-hydroxyethyl)azanium?
benzyl-[(2-bromo-4,5-dimethoxyphenyl)methyl]-(2-hydroxyethyl)azanium has a molecular weight of 381.29 g/mol, XLogP of 2.04, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-[(2-bromo-4,5-dimethoxyphenyl)methyl]-(2-hydroxyethyl)azanium is sourced from PubChem (CID 7442845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).