C13H13N5OS — CID 7447734
2-[4-[(3S)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-1,3-thiazol-2-yl]guanidine (PubChem CID 7447734) has the molecular formula C13H13N5OS and a molecular weight of 287.35 g/mol. Its IUPAC name is 2-[4-[(3S)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[(3S)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 7447734 |
| Molecular Formula | C13H13N5OS |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-[4-[(3S)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-1,3-thiazol-2-yl]guanidine |
| SMILES | C[C@@H]1C(=O)Nc2ccc(-c3csc(N=C(N)N)n3)cc21 |
| InChI | InChI=1S/C13H13N5OS/c1-6-8-4-7(2-3-9(8)16-11(6)19)10-5-20-13(17-10)18-12(14)15/h2-6H,1H3,(H,16,19)(H4,14,15,17,18)/t6-/m0/s1 |
| InChIKey | CQUNHLZVPLLHNG-LURJTMIESA-N |
| XLogP | 1.77 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|