C23H35N7O3S — CID 74508904
1-(2-methoxyethyl)-3-[1-oxo-4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]thiourea (PubChem CID 74508904) has the molecular formula C23H35N7O3S and a molecular weight of 489.65 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[1-oxo-4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]thiourea.
| Compound Name | 1-(2-methoxyethyl)-3-[1-oxo-4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]thiourea |
|---|---|
| PubChem CID | 74508904 |
| Molecular Formula | C23H35N7O3S |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[1-oxo-4-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-7-yl]thiourea |
| SMILES | COCCNC(=S)NC1CC2C(=O)NCC(CCC(=O)N3CCN(c4ccccn4)CC3)N2C1 |
| InChI | InChI=1S/C23H35N7O3S/c1-33-13-8-25-23(34)27-17-14-19-22(32)26-15-18(30(19)16-17)5-6-21(31)29-11-9-28(10-12-29)20-4-2-3-7-24-20/h2-4,7,17-19H,5-6,8-16H2,1H3,(H,26,32)(H2,25,27,34) |
| InChIKey | IJUOVYMWRJOISP-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|