C24H24NO+ — CID 7451823
(2R,3R,6S)-3-benzyl-2,6-diphenylpiperidin-1-ium-4-one (PubChem CID 7451823) has the molecular formula C24H24NO+ and a molecular weight of 342.46 g/mol. Its IUPAC name is (2R,3R,6S)-3-benzyl-2,6-diphenylpiperidin-1-ium-4-one.
| Compound Name | (2R,3R,6S)-3-benzyl-2,6-diphenylpiperidin-1-ium-4-one |
|---|---|
| PubChem CID | 7451823 |
| Molecular Formula | C24H24NO+ |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (2R,3R,6S)-3-benzyl-2,6-diphenylpiperidin-1-ium-4-one |
| SMILES | O=C1C[C@@H](c2ccccc2)[NH2+][C@@H](c2ccccc2)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C24H23NO/c26-23-17-22(19-12-6-2-7-13-19)25-24(20-14-8-3-9-15-20)21(23)16-18-10-4-1-5-11-18/h1-15,21-22,24-25H,16-17H2/p+1/t21-,22-,24-/m0/s1 |
| InChIKey | ZHMWAECVOGMYGO-FIXSFTCYSA-O |
| XLogP | 3.86 |
| TPSA | 33.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |