C14H23N4O3+ — CID 7461332
5-[C-ethyl-N-(2-piperidin-1-ium-1-ylethyl)carbonimidoyl]-1,3-diazinane-2,4,6-trione (PubChem CID 7461332) has the molecular formula C14H23N4O3+ and a molecular weight of 295.36 g/mol. Its IUPAC name is 5-[C-ethyl-N-(2-piperidin-1-ium-1-ylethyl)carbonimidoyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[C-ethyl-N-(2-piperidin-1-ium-1-ylethyl)carbonimidoyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7461332 |
| Molecular Formula | C14H23N4O3+ |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 5-[C-ethyl-N-(2-piperidin-1-ium-1-ylethyl)carbonimidoyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC/C(=N\CC[NH+]1CCCCC1)C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C14H22N4O3/c1-2-10(11-12(19)16-14(21)17-13(11)20)15-6-9-18-7-4-3-5-8-18/h11H,2-9H2,1H3,(H2,16,17,19,20,21)/p+1/b15-10+ |
| InChIKey | ACXXMGALACUZAB-XNTDXEJSSA-O |
| XLogP | -1.11 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|