C16H28N4O3 — CID 7461934
(5R)-1-butyl-5-[N-[3-(dimethylamino)propyl]-C-ethylcarbonimidoyl]-1,3-diazinane-2,4,6-trione (PubChem CID 7461934) has the molecular formula C16H28N4O3 and a molecular weight of 324.43 g/mol. Its IUPAC name is (5R)-1-butyl-5-[N-[3-(dimethylamino)propyl]-C-ethylcarbonimidoyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5R)-1-butyl-5-[N-[3-(dimethylamino)propyl]-C-ethylcarbonimidoyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7461934 |
| Molecular Formula | C16H28N4O3 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | (5R)-1-butyl-5-[N-[3-(dimethylamino)propyl]-C-ethylcarbonimidoyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCN1C(=O)NC(=O)[C@@H](/C(CC)=N/CCCN(C)C)C1=O |
| InChI | InChI=1S/C16H28N4O3/c1-5-7-11-20-15(22)13(14(21)18-16(20)23)12(6-2)17-9-8-10-19(3)4/h13H,5-11H2,1-4H3,(H,18,21,23)/b17-12+/t13-/m1/s1 |
| InChIKey | HHQOPWVGZLRLBS-LVLBFHFTSA-N |
| XLogP | 1.28 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|