C25H21NO3 — CID 7466030
[(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 1H-indole-2-carboxylate (PubChem CID 7466030) has the molecular formula C25H21NO3 and a molecular weight of 383.45 g/mol. Its IUPAC name is [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 1H-indole-2-carboxylate.
| Compound Name | [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 7466030 |
| Molecular Formula | C25H21NO3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 1H-indole-2-carboxylate |
| SMILES | Cc1ccc(C(=O)[C@@H](OC(=O)c2cc3ccccc3[nH]2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H21NO3/c1-16-7-11-18(12-8-16)23(27)24(19-13-9-17(2)10-14-19)29-25(28)22-15-20-5-3-4-6-21(20)26-22/h3-15,24,26H,1-2H3/t24-/m0/s1 |
| InChIKey | JGYYGBHBIKDDOQ-DEOSSOPVSA-N |
| XLogP | 5.57 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |