C16H26N6O2 — CID 74691441
3-methyl-8-(4-prop-2-enylpiperazin-1-yl)-7-propyl-4,5-dihydropurine-2,6-dione (PubChem CID 74691441) has the molecular formula C16H26N6O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-methyl-8-(4-prop-2-enylpiperazin-1-yl)-7-propyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 3-methyl-8-(4-prop-2-enylpiperazin-1-yl)-7-propyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 74691441 |
| Molecular Formula | C16H26N6O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 3-methyl-8-(4-prop-2-enylpiperazin-1-yl)-7-propyl-4,5-dihydropurine-2,6-dione |
| SMILES | C=CCN1CCN(C2=NC3C(C(=O)NC(=O)N3C)N2CCC)CC1 |
| InChI | InChI=1S/C16H26N6O2/c1-4-6-20-8-10-21(11-9-20)15-17-13-12(22(15)7-5-2)14(23)18-16(24)19(13)3/h4,12-13H,1,5-11H2,2-3H3,(H,18,23,24) |
| InChIKey | XJFLTYKZDBVVNV-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|