C19H28N3OS+ — CID 7473028
(4aR,9bR)-2,8-dimethyl-N-[[(2S)-oxolan-2-yl]methyl]-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-carbothioamide (PubChem CID 7473028) has the molecular formula C19H28N3OS+ and a molecular weight of 346.52 g/mol. Its IUPAC name is (4aR,9bR)-2,8-dimethyl-N-[[(2S)-oxolan-2-yl]methyl]-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-carbothioamide.
| Compound Name | (4aR,9bR)-2,8-dimethyl-N-[[(2S)-oxolan-2-yl]methyl]-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-carbothioamide |
|---|---|
| PubChem CID | 7473028 |
| Molecular Formula | C19H28N3OS+ |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (4aR,9bR)-2,8-dimethyl-N-[[(2S)-oxolan-2-yl]methyl]-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indol-2-ium-5-carbothioamide |
| SMILES | Cc1ccc2c(c1)[C@@H]1C[NH+](C)CC[C@H]1N2C(=S)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H27N3OS/c1-13-5-6-17-15(10-13)16-12-21(2)8-7-18(16)22(17)19(24)20-11-14-4-3-9-23-14/h5-6,10,14,16,18H,3-4,7-9,11-12H2,1-2H3,(H,20,24)/p+1/t14-,16-,18+/m0/s1 |
| InChIKey | WSCKMIBHIVCVOS-QILLFSRXSA-O |
| XLogP | 1.24 |
| TPSA | 28.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|