C24H33N3O2 — CID 74791682
N-[[4-(cyclohex-3-en-1-ylmethoxy)phenyl]methyl]-N-cyclopropyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrazole-3-carboxamide (PubChem CID 74791682) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[[4-(cyclohex-3-en-1-ylmethoxy)phenyl]methyl]-N-cyclopropyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrazole-3-carboxamide.
| Compound Name | N-[[4-(cyclohex-3-en-1-ylmethoxy)phenyl]methyl]-N-cyclopropyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 74791682 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | N-[[4-(cyclohex-3-en-1-ylmethoxy)phenyl]methyl]-N-cyclopropyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrazole-3-carboxamide |
| SMILES | O=C(C1NNC2CCCC21)N(Cc1ccc(OCC2CC=CCC2)cc1)C1CC1 |
| InChI | InChI=1S/C24H33N3O2/c28-24(23-21-7-4-8-22(21)25-26-23)27(19-11-12-19)15-17-9-13-20(14-10-17)29-16-18-5-2-1-3-6-18/h1-2,9-10,13-14,18-19,21-23,25-26H,3-8,11-12,15-16H2 |
| InChIKey | OINNJWKTXASIMX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|