C31H29NO7 — CID 75069283
1-[5-ethenyl-5-methyl-6-(3-oxoprop-1-en-2-yl)cyclohexen-1-yl]propan-2-yl 6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylate (PubChem CID 75069283) has the molecular formula C31H29NO7 and a molecular weight of 527.57 g/mol. Its IUPAC name is 1-[5-ethenyl-5-methyl-6-(3-oxoprop-1-en-2-yl)cyclohexen-1-yl]propan-2-yl 6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylate.
| Compound Name | 1-[5-ethenyl-5-methyl-6-(3-oxoprop-1-en-2-yl)cyclohexen-1-yl]propan-2-yl 6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 75069283 |
| Molecular Formula | C31H29NO7 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 1-[5-ethenyl-5-methyl-6-(3-oxoprop-1-en-2-yl)cyclohexen-1-yl]propan-2-yl 6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylate |
| SMILES | C=CC1(C)CCC=C(CC(C)OC(=O)c2cc3c(c4c2c([N+](=O)[O-])cc2ccccc24)OCO3)C1C(=C)C=O |
| InChI | InChI=1S/C31H29NO7/c1-5-31(4)12-8-10-21(28(31)18(2)16-33)13-19(3)39-30(34)23-15-25-29(38-17-37-25)27-22-11-7-6-9-20(22)14-24(26(23)27)32(35)36/h5-7,9-11,14-16,19,28H,1-2,8,12-13,17H2,3-4H3 |
| InChIKey | IIBMSRRBRIHDMP-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|