C16H9NO7 — CID 46872931
9-hydroxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid (PubChem CID 46872931) has the molecular formula C16H9NO7 and a molecular weight of 327.25 g/mol. Its IUPAC name is 9-hydroxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid.
| Compound Name | 9-hydroxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid |
|---|---|
| PubChem CID | 46872931 |
| Molecular Formula | C16H9NO7 |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 9-hydroxy-6-nitronaphtho[2,1-g][1,3]benzodioxole-5-carboxylic acid |
| SMILES | O=C(O)c1cc2c(c3c1c([N+](=O)[O-])cc1cc(O)ccc13)OCO2 |
| InChI | InChI=1S/C16H9NO7/c18-8-1-2-9-7(3-8)4-11(17(21)22)13-10(16(19)20)5-12-15(14(9)13)24-6-23-12/h1-5,18H,6H2,(H,19,20) |
| InChIKey | BWNOCXWHNUKJRI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|