C11H15N6O3+ — CID 75117440
2-(2,4-dimethyl-1,3-dioxo-8,9a-dihydro-7H-purino[7,8-a]imidazol-6-ium-6-yl)acetamide (PubChem CID 75117440) has the molecular formula C11H15N6O3+ and a molecular weight of 279.28 g/mol. Its IUPAC name is 2-(2,4-dimethyl-1,3-dioxo-8,9a-dihydro-7H-purino[7,8-a]imidazol-6-ium-6-yl)acetamide.
| Compound Name | 2-(2,4-dimethyl-1,3-dioxo-8,9a-dihydro-7H-purino[7,8-a]imidazol-6-ium-6-yl)acetamide |
|---|---|
| PubChem CID | 75117440 |
| Molecular Formula | C11H15N6O3+ |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-(2,4-dimethyl-1,3-dioxo-8,9a-dihydro-7H-purino[7,8-a]imidazol-6-ium-6-yl)acetamide |
| SMILES | CN1C(=O)C2C(=NC3=[N+](CC(N)=O)CCN32)N(C)C1=O |
| InChI | InChI=1S/C11H14N6O3/c1-14-8-7(9(19)15(2)11(14)20)17-4-3-16(5-6(12)18)10(17)13-8/h7H,3-5H2,1-2H3,(H-,12,18)/p+1 |
| InChIKey | NAXNMZQZVGNKLB-UHFFFAOYSA-O |
| XLogP | -2.54 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|