C22H19NO3S — CID 75202128
3-[4-[(1-thiophen-3-ylindol-6-yl)methoxy]phenyl]propanoic acid (PubChem CID 75202128) has the molecular formula C22H19NO3S and a molecular weight of 377.47 g/mol. Its IUPAC name is 3-[4-[(1-thiophen-3-ylindol-6-yl)methoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[(1-thiophen-3-ylindol-6-yl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 75202128 |
| Molecular Formula | C22H19NO3S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 3-[4-[(1-thiophen-3-ylindol-6-yl)methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCc2ccc3ccn(-c4ccsc4)c3c2)cc1 |
| InChI | InChI=1S/C22H19NO3S/c24-22(25)8-4-16-2-6-20(7-3-16)26-14-17-1-5-18-9-11-23(21(18)13-17)19-10-12-27-15-19/h1-3,5-7,9-13,15H,4,8,14H2,(H,24,25) |
| InChIKey | YSPMUJZNTVZOSD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |