C16H18O10 — CID 75203654
8-hydroxy-4-(8-hydroxy-9-oxo-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-4-yl)-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-9-one (PubChem CID 75203654) has the molecular formula C16H18O10 and a molecular weight of 370.31 g/mol. Its IUPAC name is 8-hydroxy-4-(8-hydroxy-9-oxo-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-4-yl)-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-9-one.
| Compound Name | 8-hydroxy-4-(8-hydroxy-9-oxo-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-4-yl)-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-9-one |
|---|---|
| PubChem CID | 75203654 |
| Molecular Formula | C16H18O10 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 8-hydroxy-4-(8-hydroxy-9-oxo-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-4-yl)-3,5,10-trioxatricyclo[6.2.1.02,6]undecan-9-one |
| SMILES | O=C1OC2CC1(O)CC1OC(C3OC4CC5(O)CC(OC5=O)C4O3)OC21 |
| InChI | InChI=1S/C16H18O10/c17-13-15(19)1-5-9(7(3-15)23-13)25-11(21-5)12-22-6-2-16(20)4-8(10(6)26-12)24-14(16)18/h5-12,19-20H,1-4H2 |
| InChIKey | PVQFJPDGXOQNAM-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |